About methyl (2E)-3-oxo-2-(1,4,4-trimethylpyrrolidin-2-ylidene)propanoate
methyl (2E)-3-oxo-2-(1,4,4-trimethylpyrrolidin-2-ylidene)propanoate (PubChem CID 11063727) has the molecular formula C11H17NO3
and a molecular weight of 211.26 g/mol. Its IUPAC name is methyl (2E)-3-oxo-2-(1,4,4-trimethylpyrrolidin-2-ylidene)propanoate.
Molecular Properties
| Compound Name | methyl (2E)-3-oxo-2-(1,4,4-trimethylpyrrolidin-2-ylidene)propanoate |
| PubChem CID | 11063727 |
| Molecular Formula | C11H17NO3 |
| Molecular Weight | 211.26 g/mol |
| Exact Mass | 211.12 |
| IUPAC Name | methyl (2E)-3-oxo-2-(1,4,4-trimethylpyrrolidin-2-ylidene)propanoate |
| SMILES | COC(=O)/C(C=O)=C1\CC(C)(C)CN1C |
| InChI | InChI=1S/C11H17NO3/c1-11(2)5-9(12(3)7-11)8(6-13)10(14)15-4/h6H,5,7H2,1-4H3/b9-8+ |
| InChIKey | LLVKIYICJQJOKK-CMDGGOBGSA-N |
| XLogP | 0.97 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.26 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|
Analyze methyl (2E)-3-oxo-2-(1,4,4-trimethylpyrrolidin-2-ylidene)propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (2E)-3-oxo-2-(1,4,4-trimethylpyrrolidin-2-ylidene)propanoate?
The IUPAC name of methyl (2E)-3-oxo-2-(1,4,4-trimethylpyrrolidin-2-ylidene)propanoate (CID 11063727) is methyl (2E)-3-oxo-2-(1,4,4-trimethylpyrrolidin-2-ylidene)propanoate.
What is the SMILES notation for methyl (2E)-3-oxo-2-(1,4,4-trimethylpyrrolidin-2-ylidene)propanoate?
The canonical SMILES for methyl (2E)-3-oxo-2-(1,4,4-trimethylpyrrolidin-2-ylidene)propanoate is COC(=O)/C(C=O)=C1\CC(C)(C)CN1C.
What is the InChIKey of methyl (2E)-3-oxo-2-(1,4,4-trimethylpyrrolidin-2-ylidene)propanoate?
The InChIKey is LLVKIYICJQJOKK-CMDGGOBGSA-N. The full InChI is InChI=1S/C11H17NO3/c1-11(2)5-9(12(3)7-11)8(6-13)10(14)15-4/h6H,5,7H2,1-4H3/b9-8+.
What are the key properties of methyl (2E)-3-oxo-2-(1,4,4-trimethylpyrrolidin-2-ylidene)propanoate?
methyl (2E)-3-oxo-2-(1,4,4-trimethylpyrrolidin-2-ylidene)propanoate has a molecular weight of 211.26 g/mol, XLogP of 0.97, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (2E)-3-oxo-2-(1,4,4-trimethylpyrrolidin-2-ylidene)propanoate is sourced from PubChem (CID 11063727), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).