C20H26N2O4S — CID 110637700
N-[4-(3,3-dimethylmorpholin-4-yl)phenyl]-4-ethoxybenzenesulfonamide (PubChem CID 110637700) has the molecular formula C20H26N2O4S and a molecular weight of 390.51 g/mol. Its IUPAC name is N-[4-(3,3-dimethylmorpholin-4-yl)phenyl]-4-ethoxybenzenesulfonamide.
| Compound Name | N-[4-(3,3-dimethylmorpholin-4-yl)phenyl]-4-ethoxybenzenesulfonamide |
|---|---|
| PubChem CID | 110637700 |
| Molecular Formula | C20H26N2O4S |
| Molecular Weight | 390.51 g/mol |
| Exact Mass | 390.16 |
| IUPAC Name | N-[4-(3,3-dimethylmorpholin-4-yl)phenyl]-4-ethoxybenzenesulfonamide |
| SMILES | CCOc1ccc(S(=O)(=O)Nc2ccc(N3CCOCC3(C)C)cc2)cc1 |
| InChI | InChI=1S/C20H26N2O4S/c1-4-26-18-9-11-19(12-10-18)27(23,24)21-16-5-7-17(8-6-16)22-13-14-25-15-20(22,2)3/h5-12,21H,4,13-15H2,1-3H3 |
| InChIKey | NRYOSXZGSCBZIP-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.51 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |