C15H25N — CID 11063944
(2S,4aS,5R,8aS)-2,5-bis(prop-2-enyl)-1,2,3,4,4a,5,6,7,8,8a-decahydroquinoline (PubChem CID 11063944) has the molecular formula C15H25N and a molecular weight of 219.37 g/mol. Its IUPAC name is (2S,4aS,5R,8aS)-2,5-bis(prop-2-enyl)-1,2,3,4,4a,5,6,7,8,8a-decahydroquinoline.
| Compound Name | (2S,4aS,5R,8aS)-2,5-bis(prop-2-enyl)-1,2,3,4,4a,5,6,7,8,8a-decahydroquinoline |
|---|---|
| PubChem CID | 11063944 |
| Molecular Formula | C15H25N |
| Molecular Weight | 219.37 g/mol |
| Exact Mass | 219.20 |
| IUPAC Name | (2S,4aS,5R,8aS)-2,5-bis(prop-2-enyl)-1,2,3,4,4a,5,6,7,8,8a-decahydroquinoline |
| SMILES | C=CC[C@@H]1CC[C@H]2[C@@H](CC=C)CCC[C@@H]2N1 |
| InChI | InChI=1S/C15H25N/c1-3-6-12-8-5-9-15-14(12)11-10-13(16-15)7-4-2/h3-4,12-16H,1-2,5-11H2/t12-,13+,14-,15-/m0/s1 |
| InChIKey | MPVIDXQYRAHWKE-XGUBFFRZSA-N |
| XLogP | 3.68 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.37 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|