C18H21FN2O2S — CID 110640404
4-fluoro-N-[[1-(4-methylphenyl)pyrrolidin-3-yl]methyl]benzenesulfonamide (PubChem CID 110640404) has the molecular formula C18H21FN2O2S and a molecular weight of 348.44 g/mol. Its IUPAC name is 4-fluoro-N-[[1-(4-methylphenyl)pyrrolidin-3-yl]methyl]benzenesulfonamide.
| Compound Name | 4-fluoro-N-[[1-(4-methylphenyl)pyrrolidin-3-yl]methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 110640404 |
| Molecular Formula | C18H21FN2O2S |
| Molecular Weight | 348.44 g/mol |
| Exact Mass | 348.13 |
| IUPAC Name | 4-fluoro-N-[[1-(4-methylphenyl)pyrrolidin-3-yl]methyl]benzenesulfonamide |
| SMILES | Cc1ccc(N2CCC(CNS(=O)(=O)c3ccc(F)cc3)C2)cc1 |
| InChI | InChI=1S/C18H21FN2O2S/c1-14-2-6-17(7-3-14)21-11-10-15(13-21)12-20-24(22,23)18-8-4-16(19)5-9-18/h2-9,15,20H,10-13H2,1H3 |
| InChIKey | JYGYBKFDNHGBKH-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.44 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|