About (3S,4R)-3,4-dihydroxy-5-phenylmethoxypentan-2-one
(3S,4R)-3,4-dihydroxy-5-phenylmethoxypentan-2-one (PubChem CID 11064071) has the molecular formula C12H16O4
and a molecular weight of 224.26 g/mol. Its IUPAC name is (3S,4R)-3,4-dihydroxy-5-phenylmethoxypentan-2-one.
Molecular Properties
| Compound Name | (3S,4R)-3,4-dihydroxy-5-phenylmethoxypentan-2-one |
| PubChem CID | 11064071 |
| Molecular Formula | C12H16O4 |
| Molecular Weight | 224.26 g/mol |
| Exact Mass | 224.10 |
| IUPAC Name | (3S,4R)-3,4-dihydroxy-5-phenylmethoxypentan-2-one |
| SMILES | CC(=O)[C@@H](O)[C@H](O)COCc1ccccc1 |
| InChI | InChI=1S/C12H16O4/c1-9(13)12(15)11(14)8-16-7-10-5-3-2-4-6-10/h2-6,11-12,14-15H,7-8H2,1H3/t11-,12-/m1/s1 |
| InChIKey | RWZATQKQMVVYJV-VXGBXAGGSA-N |
| XLogP | 0.51 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.26 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (3S,4R)-3,4-dihydroxy-5-phenylmethoxypentan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S,4R)-3,4-dihydroxy-5-phenylmethoxypentan-2-one?
The IUPAC name of (3S,4R)-3,4-dihydroxy-5-phenylmethoxypentan-2-one (CID 11064071) is (3S,4R)-3,4-dihydroxy-5-phenylmethoxypentan-2-one.
What is the SMILES notation for (3S,4R)-3,4-dihydroxy-5-phenylmethoxypentan-2-one?
The canonical SMILES for (3S,4R)-3,4-dihydroxy-5-phenylmethoxypentan-2-one is CC(=O)[C@@H](O)[C@H](O)COCc1ccccc1.
What is the InChIKey of (3S,4R)-3,4-dihydroxy-5-phenylmethoxypentan-2-one?
The InChIKey is RWZATQKQMVVYJV-VXGBXAGGSA-N. The full InChI is InChI=1S/C12H16O4/c1-9(13)12(15)11(14)8-16-7-10-5-3-2-4-6-10/h2-6,11-12,14-15H,7-8H2,1H3/t11-,12-/m1/s1.
What are the key properties of (3S,4R)-3,4-dihydroxy-5-phenylmethoxypentan-2-one?
(3S,4R)-3,4-dihydroxy-5-phenylmethoxypentan-2-one has a molecular weight of 224.26 g/mol, XLogP of 0.51, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3S,4R)-3,4-dihydroxy-5-phenylmethoxypentan-2-one is sourced from PubChem (CID 11064071), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).