About 1,3-oxathiolan-2-ylmethyl benzoate
1,3-oxathiolan-2-ylmethyl benzoate (PubChem CID 11064076) has the molecular formula C11H12O3S
and a molecular weight of 224.28 g/mol. Its IUPAC name is 1,3-oxathiolan-2-ylmethyl benzoate.
Molecular Properties
| Compound Name | 1,3-oxathiolan-2-ylmethyl benzoate |
| PubChem CID | 11064076 |
| Molecular Formula | C11H12O3S |
| Molecular Weight | 224.28 g/mol |
| Exact Mass | 224.05 |
| IUPAC Name | 1,3-oxathiolan-2-ylmethyl benzoate |
| SMILES | O=C(OCC1OCCS1)c1ccccc1 |
| InChI | InChI=1S/C11H12O3S/c12-11(9-4-2-1-3-5-9)14-8-10-13-6-7-15-10/h1-5,10H,6-8H2 |
| InChIKey | PCXPPEVXIKTQGP-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.28 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1,3-oxathiolan-2-ylmethyl benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-oxathiolan-2-ylmethyl benzoate?
The IUPAC name of 1,3-oxathiolan-2-ylmethyl benzoate (CID 11064076) is 1,3-oxathiolan-2-ylmethyl benzoate.
What is the SMILES notation for 1,3-oxathiolan-2-ylmethyl benzoate?
The canonical SMILES for 1,3-oxathiolan-2-ylmethyl benzoate is O=C(OCC1OCCS1)c1ccccc1.
What is the InChIKey of 1,3-oxathiolan-2-ylmethyl benzoate?
The InChIKey is PCXPPEVXIKTQGP-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12O3S/c12-11(9-4-2-1-3-5-9)14-8-10-13-6-7-15-10/h1-5,10H,6-8H2.
What are the key properties of 1,3-oxathiolan-2-ylmethyl benzoate?
1,3-oxathiolan-2-ylmethyl benzoate has a molecular weight of 224.28 g/mol, XLogP of 1.93, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-oxathiolan-2-ylmethyl benzoate is sourced from PubChem (CID 11064076), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).