C14H17BrN2O2S — CID 110641583
4-bromo-N-[2-(2,5-dimethyl-1H-pyrrol-3-yl)ethyl]benzenesulfonamide (PubChem CID 110641583) has the molecular formula C14H17BrN2O2S and a molecular weight of 357.27 g/mol. Its IUPAC name is 4-bromo-N-[2-(2,5-dimethyl-1H-pyrrol-3-yl)ethyl]benzenesulfonamide.
| Compound Name | 4-bromo-N-[2-(2,5-dimethyl-1H-pyrrol-3-yl)ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 110641583 |
| Molecular Formula | C14H17BrN2O2S |
| Molecular Weight | 357.27 g/mol |
| Exact Mass | 356.02 |
| IUPAC Name | 4-bromo-N-[2-(2,5-dimethyl-1H-pyrrol-3-yl)ethyl]benzenesulfonamide |
| SMILES | Cc1cc(CCNS(=O)(=O)c2ccc(Br)cc2)c(C)[nH]1 |
| InChI | InChI=1S/C14H17BrN2O2S/c1-10-9-12(11(2)17-10)7-8-16-20(18,19)14-5-3-13(15)4-6-14/h3-6,9,16-17H,7-8H2,1-2H3 |
| InChIKey | FELSEAJURLYKDZ-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 61.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.27 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |