About CID 11064179
CID 11064179 (PubChem CID 11064179) has the molecular formula C12H23N2O2
and a molecular weight of 227.33 g/mol.
Molecular Properties
| Compound Name | CID 11064179 |
| PubChem CID | 11064179 |
| Molecular Formula | C12H23N2O2 |
| Molecular Weight | 227.33 g/mol |
| Exact Mass | 227.18 |
| IUPAC Name | — |
| SMILES | CC(C)(C)N1CC(C)(C)N([O])C(C)(C)C1=O |
| InChI | InChI=1S/C12H23N2O2/c1-10(2,3)13-8-11(4,5)14(16)12(6,7)9(13)15/h8H2,1-7H3 |
| InChIKey | BXFRYHSDSGFYJM-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 43.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.33 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze CID 11064179 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 11064179?
The IUPAC name of CID 11064179 (CID 11064179) is not available.
What is the SMILES notation for CID 11064179?
The canonical SMILES for CID 11064179 is CC(C)(C)N1CC(C)(C)N([O])C(C)(C)C1=O.
What is the InChIKey of CID 11064179?
The InChIKey is BXFRYHSDSGFYJM-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H23N2O2/c1-10(2,3)13-8-11(4,5)14(16)12(6,7)9(13)15/h8H2,1-7H3.
What are the key properties of CID 11064179?
CID 11064179 has a molecular weight of 227.33 g/mol, XLogP of 1.83, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 11064179 is sourced from PubChem (CID 11064179), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).