About 2-[2-(2,4-difluorophenyl)prop-2-enyl]propane-1,3-diol
2-[2-(2,4-difluorophenyl)prop-2-enyl]propane-1,3-diol (PubChem CID 11064187) has the molecular formula C12H14F2O2
and a molecular weight of 228.24 g/mol. Its IUPAC name is 2-[2-(2,4-difluorophenyl)prop-2-enyl]propane-1,3-diol.
Molecular Properties
| Compound Name | 2-[2-(2,4-difluorophenyl)prop-2-enyl]propane-1,3-diol |
| PubChem CID | 11064187 |
| Molecular Formula | C12H14F2O2 |
| Molecular Weight | 228.24 g/mol |
| Exact Mass | 228.10 |
| IUPAC Name | 2-[2-(2,4-difluorophenyl)prop-2-enyl]propane-1,3-diol |
| SMILES | C=C(CC(CO)CO)c1ccc(F)cc1F |
| InChI | InChI=1S/C12H14F2O2/c1-8(4-9(6-15)7-16)11-3-2-10(13)5-12(11)14/h2-3,5,9,15-16H,1,4,6-7H2 |
| InChIKey | WOLIKRXEOQATPC-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.24 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-[2-(2,4-difluorophenyl)prop-2-enyl]propane-1,3-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-(2,4-difluorophenyl)prop-2-enyl]propane-1,3-diol?
The IUPAC name of 2-[2-(2,4-difluorophenyl)prop-2-enyl]propane-1,3-diol (CID 11064187) is 2-[2-(2,4-difluorophenyl)prop-2-enyl]propane-1,3-diol.
What is the SMILES notation for 2-[2-(2,4-difluorophenyl)prop-2-enyl]propane-1,3-diol?
The canonical SMILES for 2-[2-(2,4-difluorophenyl)prop-2-enyl]propane-1,3-diol is C=C(CC(CO)CO)c1ccc(F)cc1F.
What is the InChIKey of 2-[2-(2,4-difluorophenyl)prop-2-enyl]propane-1,3-diol?
The InChIKey is WOLIKRXEOQATPC-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14F2O2/c1-8(4-9(6-15)7-16)11-3-2-10(13)5-12(11)14/h2-3,5,9,15-16H,1,4,6-7H2.
What are the key properties of 2-[2-(2,4-difluorophenyl)prop-2-enyl]propane-1,3-diol?
2-[2-(2,4-difluorophenyl)prop-2-enyl]propane-1,3-diol has a molecular weight of 228.24 g/mol, XLogP of 1.97, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(2,4-difluorophenyl)prop-2-enyl]propane-1,3-diol is sourced from PubChem (CID 11064187), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).