C14H15FN2O — CID 110641872
N-[(2,5-dimethyl-1H-pyrrol-3-yl)methyl]-3-fluorobenzamide (PubChem CID 110641872) has the molecular formula C14H15FN2O and a molecular weight of 246.28 g/mol. Its IUPAC name is N-[(2,5-dimethyl-1H-pyrrol-3-yl)methyl]-3-fluorobenzamide.
| Compound Name | N-[(2,5-dimethyl-1H-pyrrol-3-yl)methyl]-3-fluorobenzamide |
|---|---|
| PubChem CID | 110641872 |
| Molecular Formula | C14H15FN2O |
| Molecular Weight | 246.28 g/mol |
| Exact Mass | 246.12 |
| IUPAC Name | N-[(2,5-dimethyl-1H-pyrrol-3-yl)methyl]-3-fluorobenzamide |
| SMILES | Cc1cc(CNC(=O)c2cccc(F)c2)c(C)[nH]1 |
| InChI | InChI=1S/C14H15FN2O/c1-9-6-12(10(2)17-9)8-16-14(18)11-4-3-5-13(15)7-11/h3-7,17H,8H2,1-2H3,(H,16,18) |
| InChIKey | MOQHTZUSHYRYIL-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 44.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.28 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |