C20H21N5O2 — CID 110642272
N-benzyl-4-(5-phenyl-1,3,4-oxadiazol-2-yl)piperazine-1-carboxamide (PubChem CID 110642272) has the molecular formula C20H21N5O2 and a molecular weight of 363.42 g/mol. Its IUPAC name is N-benzyl-4-(5-phenyl-1,3,4-oxadiazol-2-yl)piperazine-1-carboxamide.
| Compound Name | N-benzyl-4-(5-phenyl-1,3,4-oxadiazol-2-yl)piperazine-1-carboxamide |
|---|---|
| PubChem CID | 110642272 |
| Molecular Formula | C20H21N5O2 |
| Molecular Weight | 363.42 g/mol |
| Exact Mass | 363.17 |
| IUPAC Name | N-benzyl-4-(5-phenyl-1,3,4-oxadiazol-2-yl)piperazine-1-carboxamide |
| SMILES | O=C(NCc1ccccc1)N1CCN(c2nnc(-c3ccccc3)o2)CC1 |
| InChI | InChI=1S/C20H21N5O2/c26-19(21-15-16-7-3-1-4-8-16)24-11-13-25(14-12-24)20-23-22-18(27-20)17-9-5-2-6-10-17/h1-10H,11-15H2,(H,21,26) |
| InChIKey | DCCRYDRTBUQDCJ-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 74.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.42 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |