C18H27NO4S — CID 110642380
4-cyclopentyloxy-N-[[1-(hydroxymethyl)cyclopentyl]methyl]benzenesulfonamide (PubChem CID 110642380) has the molecular formula C18H27NO4S and a molecular weight of 353.48 g/mol. Its IUPAC name is 4-cyclopentyloxy-N-[[1-(hydroxymethyl)cyclopentyl]methyl]benzenesulfonamide.
| Compound Name | 4-cyclopentyloxy-N-[[1-(hydroxymethyl)cyclopentyl]methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 110642380 |
| Molecular Formula | C18H27NO4S |
| Molecular Weight | 353.48 g/mol |
| Exact Mass | 353.17 |
| IUPAC Name | 4-cyclopentyloxy-N-[[1-(hydroxymethyl)cyclopentyl]methyl]benzenesulfonamide |
| SMILES | O=S(=O)(NCC1(CO)CCCC1)c1ccc(OC2CCCC2)cc1 |
| InChI | InChI=1S/C18H27NO4S/c20-14-18(11-3-4-12-18)13-19-24(21,22)17-9-7-16(8-10-17)23-15-5-1-2-6-15/h7-10,15,19-20H,1-6,11-14H2 |
| InChIKey | MXTMOQHYFDOZIV-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.48 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |