C13H18N4O3S — CID 110642497
5-(4-ethylsulfonylpiperazin-1-yl)-1,3-dihydrobenzimidazol-2-one (PubChem CID 110642497) has the molecular formula C13H18N4O3S and a molecular weight of 310.38 g/mol. Its IUPAC name is 5-(4-ethylsulfonylpiperazin-1-yl)-1,3-dihydrobenzimidazol-2-one.
| Compound Name | 5-(4-ethylsulfonylpiperazin-1-yl)-1,3-dihydrobenzimidazol-2-one |
|---|---|
| PubChem CID | 110642497 |
| Molecular Formula | C13H18N4O3S |
| Molecular Weight | 310.38 g/mol |
| Exact Mass | 310.11 |
| IUPAC Name | 5-(4-ethylsulfonylpiperazin-1-yl)-1,3-dihydrobenzimidazol-2-one |
| SMILES | CCS(=O)(=O)N1CCN(c2ccc3[nH]c(=O)[nH]c3c2)CC1 |
| InChI | InChI=1S/C13H18N4O3S/c1-2-21(19,20)17-7-5-16(6-8-17)10-3-4-11-12(9-10)15-13(18)14-11/h3-4,9H,2,5-8H2,1H3,(H2,14,15,18) |
| InChIKey | GWSUYMDNUWPQMG-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 89.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.38 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |