C12H21BN2Si — CID 11064285
(1,3-dimethyl-1,3,2-diazaborolidin-2-yl)-dimethyl-phenylsilane (PubChem CID 11064285) has the molecular formula C12H21BN2Si and a molecular weight of 232.21 g/mol. Its IUPAC name is (1,3-dimethyl-1,3,2-diazaborolidin-2-yl)-dimethyl-phenylsilane.
| Compound Name | (1,3-dimethyl-1,3,2-diazaborolidin-2-yl)-dimethyl-phenylsilane |
|---|---|
| PubChem CID | 11064285 |
| Molecular Formula | C12H21BN2Si |
| Molecular Weight | 232.21 g/mol |
| Exact Mass | 232.16 |
| IUPAC Name | (1,3-dimethyl-1,3,2-diazaborolidin-2-yl)-dimethyl-phenylsilane |
| SMILES | CN1CCN(C)B1[Si](C)(C)c1ccccc1 |
| InChI | InChI=1S/C12H21BN2Si/c1-14-10-11-15(2)13(14)16(3,4)12-8-6-5-7-9-12/h5-9H,10-11H2,1-4H3 |
| InChIKey | SVPVGUNIUAGVSR-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.21 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|