About 3-[(4-azido-3-pyridinyl)methyl]-1,3-thiazol-2-imine
3-[(4-azido-3-pyridinyl)methyl]-1,3-thiazol-2-imine (PubChem CID 11064290) has the molecular formula C9H8N6S
and a molecular weight of 232.27 g/mol. Its IUPAC name is 3-[(4-azido-3-pyridinyl)methyl]-1,3-thiazol-2-imine.
Molecular Properties
| Compound Name | 3-[(4-azido-3-pyridinyl)methyl]-1,3-thiazol-2-imine |
| PubChem CID | 11064290 |
| Molecular Formula | C9H8N6S |
| Molecular Weight | 232.27 g/mol |
| Exact Mass | 232.05 |
| IUPAC Name | 3-[(4-azido-3-pyridinyl)methyl]-1,3-thiazol-2-imine |
| SMILES | [H]/N=c1\sccn1Cc1cnccc1N=[N+]=[N-] |
| InChI | InChI=1S/C9H8N6S/c10-9-15(3-4-16-9)6-7-5-12-2-1-8(7)13-14-11/h1-5,10H,6H2/b10-9- |
| InChIKey | PVEOMJKSHICWQT-KTKRTIGZSA-N |
| XLogP | 2.41 |
| TPSA | 90.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.27 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze 3-[(4-azido-3-pyridinyl)methyl]-1,3-thiazol-2-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(4-azido-3-pyridinyl)methyl]-1,3-thiazol-2-imine?
The IUPAC name of 3-[(4-azido-3-pyridinyl)methyl]-1,3-thiazol-2-imine (CID 11064290) is 3-[(4-azido-3-pyridinyl)methyl]-1,3-thiazol-2-imine.
What is the SMILES notation for 3-[(4-azido-3-pyridinyl)methyl]-1,3-thiazol-2-imine?
The canonical SMILES for 3-[(4-azido-3-pyridinyl)methyl]-1,3-thiazol-2-imine is [H]/N=c1\sccn1Cc1cnccc1N=[N+]=[N-].
What is the InChIKey of 3-[(4-azido-3-pyridinyl)methyl]-1,3-thiazol-2-imine?
The InChIKey is PVEOMJKSHICWQT-KTKRTIGZSA-N. The full InChI is InChI=1S/C9H8N6S/c10-9-15(3-4-16-9)6-7-5-12-2-1-8(7)13-14-11/h1-5,10H,6H2/b10-9-.
What are the key properties of 3-[(4-azido-3-pyridinyl)methyl]-1,3-thiazol-2-imine?
3-[(4-azido-3-pyridinyl)methyl]-1,3-thiazol-2-imine has a molecular weight of 232.27 g/mol, XLogP of 2.41, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(4-azido-3-pyridinyl)methyl]-1,3-thiazol-2-imine is sourced from PubChem (CID 11064290), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).