C19H25N3O2 — CID 110643519
N,N-diethyl-4-(1H-indole-3-carbonyl)piperidine-1-carboxamide (PubChem CID 110643519) has the molecular formula C19H25N3O2 and a molecular weight of 327.43 g/mol. Its IUPAC name is N,N-diethyl-4-(1H-indole-3-carbonyl)piperidine-1-carboxamide.
| Compound Name | N,N-diethyl-4-(1H-indole-3-carbonyl)piperidine-1-carboxamide |
|---|---|
| PubChem CID | 110643519 |
| Molecular Formula | C19H25N3O2 |
| Molecular Weight | 327.43 g/mol |
| Exact Mass | 327.19 |
| IUPAC Name | N,N-diethyl-4-(1H-indole-3-carbonyl)piperidine-1-carboxamide |
| SMILES | CCN(CC)C(=O)N1CCC(C(=O)c2c[nH]c3ccccc23)CC1 |
| InChI | InChI=1S/C19H25N3O2/c1-3-21(4-2)19(24)22-11-9-14(10-12-22)18(23)16-13-20-17-8-6-5-7-15(16)17/h5-8,13-14,20H,3-4,9-12H2,1-2H3 |
| InChIKey | FKYRBSUKZBMXDC-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 56.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.43 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |