About methyl 4-bromobenzenesulfinate
methyl 4-bromobenzenesulfinate (PubChem CID 11064369) has the molecular formula C7H7BrO2S
and a molecular weight of 235.10 g/mol. Its IUPAC name is methyl 4-bromobenzenesulfinate.
Molecular Properties
| Compound Name | methyl 4-bromobenzenesulfinate |
| PubChem CID | 11064369 |
| Molecular Formula | C7H7BrO2S |
| Molecular Weight | 235.10 g/mol |
| Exact Mass | 233.94 |
| IUPAC Name | methyl 4-bromobenzenesulfinate |
| SMILES | COS(=O)c1ccc(Br)cc1 |
| InChI | InChI=1S/C7H7BrO2S/c1-10-11(9)7-4-2-6(8)3-5-7/h2-5H,1H3 |
| InChIKey | QFWNQAYWEZGIKI-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.10 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze methyl 4-bromobenzenesulfinate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 4-bromobenzenesulfinate?
The IUPAC name of methyl 4-bromobenzenesulfinate (CID 11064369) is methyl 4-bromobenzenesulfinate.
What is the SMILES notation for methyl 4-bromobenzenesulfinate?
The canonical SMILES for methyl 4-bromobenzenesulfinate is COS(=O)c1ccc(Br)cc1.
What is the InChIKey of methyl 4-bromobenzenesulfinate?
The InChIKey is QFWNQAYWEZGIKI-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7BrO2S/c1-10-11(9)7-4-2-6(8)3-5-7/h2-5H,1H3.
What are the key properties of methyl 4-bromobenzenesulfinate?
methyl 4-bromobenzenesulfinate has a molecular weight of 235.10 g/mol, XLogP of 2.12, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-bromobenzenesulfinate is sourced from PubChem (CID 11064369), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).