C16H24N2O2 — CID 110643919
2-benzyl-N,N-diethylmorpholine-4-carboxamide (PubChem CID 110643919) has the molecular formula C16H24N2O2 and a molecular weight of 276.38 g/mol. Its IUPAC name is 2-benzyl-N,N-diethylmorpholine-4-carboxamide.
| Compound Name | 2-benzyl-N,N-diethylmorpholine-4-carboxamide |
|---|---|
| PubChem CID | 110643919 |
| Molecular Formula | C16H24N2O2 |
| Molecular Weight | 276.38 g/mol |
| Exact Mass | 276.18 |
| IUPAC Name | 2-benzyl-N,N-diethylmorpholine-4-carboxamide |
| SMILES | CCN(CC)C(=O)N1CCOC(Cc2ccccc2)C1 |
| InChI | InChI=1S/C16H24N2O2/c1-3-17(4-2)16(19)18-10-11-20-15(13-18)12-14-8-6-5-7-9-14/h5-9,15H,3-4,10-13H2,1-2H3 |
| InChIKey | WMEWGDONFIZWPK-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.38 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |