C19H20N2O3S — CID 110644115
2-(2-benzyl-5-methylmorpholin-4-yl)sulfonylbenzonitrile (PubChem CID 110644115) has the molecular formula C19H20N2O3S and a molecular weight of 356.45 g/mol. Its IUPAC name is 2-(2-benzyl-5-methylmorpholin-4-yl)sulfonylbenzonitrile.
| Compound Name | 2-(2-benzyl-5-methylmorpholin-4-yl)sulfonylbenzonitrile |
|---|---|
| PubChem CID | 110644115 |
| Molecular Formula | C19H20N2O3S |
| Molecular Weight | 356.45 g/mol |
| Exact Mass | 356.12 |
| IUPAC Name | 2-(2-benzyl-5-methylmorpholin-4-yl)sulfonylbenzonitrile |
| SMILES | CC1COC(Cc2ccccc2)CN1S(=O)(=O)c1ccccc1C#N |
| InChI | InChI=1S/C19H20N2O3S/c1-15-14-24-18(11-16-7-3-2-4-8-16)13-21(15)25(22,23)19-10-6-5-9-17(19)12-20/h2-10,15,18H,11,13-14H2,1H3 |
| InChIKey | VCBJCRLWEKFKQB-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 70.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.45 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |