About 4-phenylsulfanyl-1,2-dihydronaphthalene
4-phenylsulfanyl-1,2-dihydronaphthalene (PubChem CID 11064465) has the molecular formula C16H14S
and a molecular weight of 238.36 g/mol. Its IUPAC name is 4-phenylsulfanyl-1,2-dihydronaphthalene.
Molecular Properties
| Compound Name | 4-phenylsulfanyl-1,2-dihydronaphthalene |
| PubChem CID | 11064465 |
| Molecular Formula | C16H14S |
| Molecular Weight | 238.36 g/mol |
| Exact Mass | 238.08 |
| IUPAC Name | 4-phenylsulfanyl-1,2-dihydronaphthalene |
| SMILES | C1=C(Sc2ccccc2)c2ccccc2CC1 |
| InChI | InChI=1S/C16H14S/c1-2-9-14(10-3-1)17-16-12-6-8-13-7-4-5-11-15(13)16/h1-5,7,9-12H,6,8H2 |
| InChIKey | WSKBUZMXAGCBOA-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.36 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-phenylsulfanyl-1,2-dihydronaphthalene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-phenylsulfanyl-1,2-dihydronaphthalene?
The IUPAC name of 4-phenylsulfanyl-1,2-dihydronaphthalene (CID 11064465) is 4-phenylsulfanyl-1,2-dihydronaphthalene.
What is the SMILES notation for 4-phenylsulfanyl-1,2-dihydronaphthalene?
The canonical SMILES for 4-phenylsulfanyl-1,2-dihydronaphthalene is C1=C(Sc2ccccc2)c2ccccc2CC1.
What is the InChIKey of 4-phenylsulfanyl-1,2-dihydronaphthalene?
The InChIKey is WSKBUZMXAGCBOA-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H14S/c1-2-9-14(10-3-1)17-16-12-6-8-13-7-4-5-11-15(13)16/h1-5,7,9-12H,6,8H2.
What are the key properties of 4-phenylsulfanyl-1,2-dihydronaphthalene?
4-phenylsulfanyl-1,2-dihydronaphthalene has a molecular weight of 238.36 g/mol, XLogP of 4.77, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-phenylsulfanyl-1,2-dihydronaphthalene is sourced from PubChem (CID 11064465), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).