C17H15FN2O2S2 — CID 110645151
N-[(5-benzyl-1,3-thiazol-2-yl)methyl]-4-fluorobenzenesulfonamide (PubChem CID 110645151) has the molecular formula C17H15FN2O2S2 and a molecular weight of 362.45 g/mol. Its IUPAC name is N-[(5-benzyl-1,3-thiazol-2-yl)methyl]-4-fluorobenzenesulfonamide.
| Compound Name | N-[(5-benzyl-1,3-thiazol-2-yl)methyl]-4-fluorobenzenesulfonamide |
|---|---|
| PubChem CID | 110645151 |
| Molecular Formula | C17H15FN2O2S2 |
| Molecular Weight | 362.45 g/mol |
| Exact Mass | 362.06 |
| IUPAC Name | N-[(5-benzyl-1,3-thiazol-2-yl)methyl]-4-fluorobenzenesulfonamide |
| SMILES | O=S(=O)(NCc1ncc(Cc2ccccc2)s1)c1ccc(F)cc1 |
| InChI | InChI=1S/C17H15FN2O2S2/c18-14-6-8-16(9-7-14)24(21,22)20-12-17-19-11-15(23-17)10-13-4-2-1-3-5-13/h1-9,11,20H,10,12H2 |
| InChIKey | HDSMOUYSCRKMHS-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.45 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |