About hexadec-1-en-3-ol
hexadec-1-en-3-ol (PubChem CID 11064533) has the molecular formula C16H32O
and a molecular weight of 240.43 g/mol. Its IUPAC name is hexadec-1-en-3-ol.
Molecular Properties
| Compound Name | hexadec-1-en-3-ol |
| PubChem CID | 11064533 |
| Molecular Formula | C16H32O |
| Molecular Weight | 240.43 g/mol |
| Exact Mass | 240.25 |
| IUPAC Name | hexadec-1-en-3-ol |
| SMILES | C=CC(O)CCCCCCCCCCCCC |
| InChI | InChI=1S/C16H32O/c1-3-5-6-7-8-9-10-11-12-13-14-15-16(17)4-2/h4,16-17H,2-3,5-15H2,1H3 |
| InChIKey | ZCTCPJHTUFYTOR-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 240.43 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze hexadec-1-en-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hexadec-1-en-3-ol?
The IUPAC name of hexadec-1-en-3-ol (CID 11064533) is hexadec-1-en-3-ol.
What is the SMILES notation for hexadec-1-en-3-ol?
The canonical SMILES for hexadec-1-en-3-ol is C=CC(O)CCCCCCCCCCCCC.
What is the InChIKey of hexadec-1-en-3-ol?
The InChIKey is ZCTCPJHTUFYTOR-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H32O/c1-3-5-6-7-8-9-10-11-12-13-14-15-16(17)4-2/h4,16-17H,2-3,5-15H2,1H3.
What are the key properties of hexadec-1-en-3-ol?
hexadec-1-en-3-ol has a molecular weight of 240.43 g/mol, XLogP of 5.23, 13 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for hexadec-1-en-3-ol is sourced from PubChem (CID 11064533), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).