C12H20O5 — CID 11064625
(2R,3R,6S)-6-(1-ethoxyethoxy)-2-[(2S,3R)-3-methyloxiran-2-yl]-3,6-dihydro-2H-pyran-3-ol (PubChem CID 11064625) has the molecular formula C12H20O5 and a molecular weight of 244.29 g/mol. Its IUPAC name is (2R,3R,6S)-6-(1-ethoxyethoxy)-2-[(2S,3R)-3-methyloxiran-2-yl]-3,6-dihydro-2H-pyran-3-ol.
| Compound Name | (2R,3R,6S)-6-(1-ethoxyethoxy)-2-[(2S,3R)-3-methyloxiran-2-yl]-3,6-dihydro-2H-pyran-3-ol |
|---|---|
| PubChem CID | 11064625 |
| Molecular Formula | C12H20O5 |
| Molecular Weight | 244.29 g/mol |
| Exact Mass | 244.13 |
| IUPAC Name | (2R,3R,6S)-6-(1-ethoxyethoxy)-2-[(2S,3R)-3-methyloxiran-2-yl]-3,6-dihydro-2H-pyran-3-ol |
| SMILES | CCOC(C)O[C@H]1C=C[C@@H](O)[C@H]([C@H]2O[C@@H]2C)O1 |
| InChI | InChI=1S/C12H20O5/c1-4-14-8(3)16-10-6-5-9(13)12(17-10)11-7(2)15-11/h5-13H,4H2,1-3H3/t7-,8?,9-,10-,11+,12-/m1/s1 |
| InChIKey | PCQNSFRAJVYQGV-ZDTFREOCSA-N |
| XLogP | 0.81 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.29 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|