C8H13BrN4 — CID 11064659
8-(3-bromopropyl)-5,6,7,8-tetrahydrotetrazolo[1,5-a]pyridine (PubChem CID 11064659) has the molecular formula C8H13BrN4 and a molecular weight of 245.12 g/mol. Its IUPAC name is 8-(3-bromopropyl)-5,6,7,8-tetrahydrotetrazolo[1,5-a]pyridine.
| Compound Name | 8-(3-bromopropyl)-5,6,7,8-tetrahydrotetrazolo[1,5-a]pyridine |
|---|---|
| PubChem CID | 11064659 |
| Molecular Formula | C8H13BrN4 |
| Molecular Weight | 245.12 g/mol |
| Exact Mass | 244.03 |
| IUPAC Name | 8-(3-bromopropyl)-5,6,7,8-tetrahydrotetrazolo[1,5-a]pyridine |
| SMILES | BrCCCC1CCCn2nnnc21 |
| InChI | InChI=1S/C8H13BrN4/c9-5-1-3-7-4-2-6-13-8(7)10-11-12-13/h7H,1-6H2 |
| InChIKey | SLBWDICCBZFICI-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.12 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|