About N-cyclopropyl-5-phenyl-1,2-oxazole-4-carboxamide
N-cyclopropyl-5-phenyl-1,2-oxazole-4-carboxamide (PubChem CID 110647274) has the molecular formula C13H12N2O2
and a molecular weight of 228.25 g/mol. Its IUPAC name is N-cyclopropyl-5-phenyl-1,2-oxazole-4-carboxamide.
Molecular Properties
| Compound Name | N-cyclopropyl-5-phenyl-1,2-oxazole-4-carboxamide |
| PubChem CID | 110647274 |
| Molecular Formula | C13H12N2O2 |
| Molecular Weight | 228.25 g/mol |
| Exact Mass | 228.09 |
| IUPAC Name | N-cyclopropyl-5-phenyl-1,2-oxazole-4-carboxamide |
| SMILES | O=C(NC1CC1)c1cnoc1-c1ccccc1 |
| InChI | InChI=1S/C13H12N2O2/c16-13(15-10-6-7-10)11-8-14-17-12(11)9-4-2-1-3-5-9/h1-5,8,10H,6-7H2,(H,15,16) |
| InChIKey | GYAUMPGDKDJKLI-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.25 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-cyclopropyl-5-phenyl-1,2-oxazole-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-cyclopropyl-5-phenyl-1,2-oxazole-4-carboxamide?
The IUPAC name of N-cyclopropyl-5-phenyl-1,2-oxazole-4-carboxamide (CID 110647274) is N-cyclopropyl-5-phenyl-1,2-oxazole-4-carboxamide.
What is the SMILES notation for N-cyclopropyl-5-phenyl-1,2-oxazole-4-carboxamide?
The canonical SMILES for N-cyclopropyl-5-phenyl-1,2-oxazole-4-carboxamide is O=C(NC1CC1)c1cnoc1-c1ccccc1.
What is the InChIKey of N-cyclopropyl-5-phenyl-1,2-oxazole-4-carboxamide?
The InChIKey is GYAUMPGDKDJKLI-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12N2O2/c16-13(15-10-6-7-10)11-8-14-17-12(11)9-4-2-1-3-5-9/h1-5,8,10H,6-7H2,(H,15,16).
What are the key properties of N-cyclopropyl-5-phenyl-1,2-oxazole-4-carboxamide?
N-cyclopropyl-5-phenyl-1,2-oxazole-4-carboxamide has a molecular weight of 228.25 g/mol, XLogP of 2.23, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-cyclopropyl-5-phenyl-1,2-oxazole-4-carboxamide is sourced from PubChem (CID 110647274), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).