C20H28N2O3 — CID 110648813
1-(1,4-dioxa-8-azaspiro[4.5]decan-8-yl)-2-(4-piperidin-1-ylphenyl)ethanone (PubChem CID 110648813) has the molecular formula C20H28N2O3 and a molecular weight of 344.45 g/mol. Its IUPAC name is 1-(1,4-dioxa-8-azaspiro[4.5]decan-8-yl)-2-(4-piperidin-1-ylphenyl)ethanone.
| Compound Name | 1-(1,4-dioxa-8-azaspiro[4.5]decan-8-yl)-2-(4-piperidin-1-ylphenyl)ethanone |
|---|---|
| PubChem CID | 110648813 |
| Molecular Formula | C20H28N2O3 |
| Molecular Weight | 344.45 g/mol |
| Exact Mass | 344.21 |
| IUPAC Name | 1-(1,4-dioxa-8-azaspiro[4.5]decan-8-yl)-2-(4-piperidin-1-ylphenyl)ethanone |
| SMILES | O=C(Cc1ccc(N2CCCCC2)cc1)N1CCC2(CC1)OCCO2 |
| InChI | InChI=1S/C20H28N2O3/c23-19(22-12-8-20(9-13-22)24-14-15-25-20)16-17-4-6-18(7-5-17)21-10-2-1-3-11-21/h4-7H,1-3,8-16H2 |
| InChIKey | BIECVFLLCUIBHO-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.45 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|