About 5-phenylsulfanyl-2,1-benzoxazole-3-carbonitrile
5-phenylsulfanyl-2,1-benzoxazole-3-carbonitrile (PubChem CID 11064901) has the molecular formula C14H8N2OS
and a molecular weight of 252.30 g/mol. Its IUPAC name is 5-phenylsulfanyl-2,1-benzoxazole-3-carbonitrile.
Molecular Properties
| Compound Name | 5-phenylsulfanyl-2,1-benzoxazole-3-carbonitrile |
| PubChem CID | 11064901 |
| Molecular Formula | C14H8N2OS |
| Molecular Weight | 252.30 g/mol |
| Exact Mass | 252.04 |
| IUPAC Name | 5-phenylsulfanyl-2,1-benzoxazole-3-carbonitrile |
| SMILES | N#Cc1onc2ccc(Sc3ccccc3)cc12 |
| InChI | InChI=1S/C14H8N2OS/c15-9-14-12-8-11(6-7-13(12)16-17-14)18-10-4-2-1-3-5-10/h1-8H |
| InChIKey | DHPYDSQXWQAVII-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 49.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.30 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-phenylsulfanyl-2,1-benzoxazole-3-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-phenylsulfanyl-2,1-benzoxazole-3-carbonitrile?
The IUPAC name of 5-phenylsulfanyl-2,1-benzoxazole-3-carbonitrile (CID 11064901) is 5-phenylsulfanyl-2,1-benzoxazole-3-carbonitrile.
What is the SMILES notation for 5-phenylsulfanyl-2,1-benzoxazole-3-carbonitrile?
The canonical SMILES for 5-phenylsulfanyl-2,1-benzoxazole-3-carbonitrile is N#Cc1onc2ccc(Sc3ccccc3)cc12.
What is the InChIKey of 5-phenylsulfanyl-2,1-benzoxazole-3-carbonitrile?
The InChIKey is DHPYDSQXWQAVII-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H8N2OS/c15-9-14-12-8-11(6-7-13(12)16-17-14)18-10-4-2-1-3-5-10/h1-8H.
What are the key properties of 5-phenylsulfanyl-2,1-benzoxazole-3-carbonitrile?
5-phenylsulfanyl-2,1-benzoxazole-3-carbonitrile has a molecular weight of 252.30 g/mol, XLogP of 3.85, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-phenylsulfanyl-2,1-benzoxazole-3-carbonitrile is sourced from PubChem (CID 11064901), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).