About N,N-diethyl-2-oxo-1,3-oxazolidine-4-carboxamide
N,N-diethyl-2-oxo-1,3-oxazolidine-4-carboxamide (PubChem CID 110649103) has the molecular formula C8H14N2O3
and a molecular weight of 186.21 g/mol. Its IUPAC name is N,N-diethyl-2-oxo-1,3-oxazolidine-4-carboxamide.
Molecular Properties
| Compound Name | N,N-diethyl-2-oxo-1,3-oxazolidine-4-carboxamide |
| PubChem CID | 110649103 |
| Molecular Formula | C8H14N2O3 |
| Molecular Weight | 186.21 g/mol |
| Exact Mass | 186.10 |
| IUPAC Name | N,N-diethyl-2-oxo-1,3-oxazolidine-4-carboxamide |
| SMILES | CCN(CC)C(=O)C1COC(=O)N1 |
| InChI | InChI=1S/C8H14N2O3/c1-3-10(4-2)7(11)6-5-13-8(12)9-6/h6H,3-5H2,1-2H3,(H,9,12) |
| InChIKey | JGFYTQBXDLLUBN-UHFFFAOYSA-N |
| XLogP | -0.04 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.21 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N,N-diethyl-2-oxo-1,3-oxazolidine-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-diethyl-2-oxo-1,3-oxazolidine-4-carboxamide?
The IUPAC name of N,N-diethyl-2-oxo-1,3-oxazolidine-4-carboxamide (CID 110649103) is N,N-diethyl-2-oxo-1,3-oxazolidine-4-carboxamide.
What is the SMILES notation for N,N-diethyl-2-oxo-1,3-oxazolidine-4-carboxamide?
The canonical SMILES for N,N-diethyl-2-oxo-1,3-oxazolidine-4-carboxamide is CCN(CC)C(=O)C1COC(=O)N1.
What is the InChIKey of N,N-diethyl-2-oxo-1,3-oxazolidine-4-carboxamide?
The InChIKey is JGFYTQBXDLLUBN-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14N2O3/c1-3-10(4-2)7(11)6-5-13-8(12)9-6/h6H,3-5H2,1-2H3,(H,9,12).
What are the key properties of N,N-diethyl-2-oxo-1,3-oxazolidine-4-carboxamide?
N,N-diethyl-2-oxo-1,3-oxazolidine-4-carboxamide has a molecular weight of 186.21 g/mol, XLogP of -0.04, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-diethyl-2-oxo-1,3-oxazolidine-4-carboxamide is sourced from PubChem (CID 110649103), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).