C21H26N2O2 — CID 110649726
N-(3,4-dimethylphenyl)-3-(4-morpholin-4-ylphenyl)propanamide (PubChem CID 110649726) has the molecular formula C21H26N2O2 and a molecular weight of 338.45 g/mol. Its IUPAC name is N-(3,4-dimethylphenyl)-3-(4-morpholin-4-ylphenyl)propanamide.
| Compound Name | N-(3,4-dimethylphenyl)-3-(4-morpholin-4-ylphenyl)propanamide |
|---|---|
| PubChem CID | 110649726 |
| Molecular Formula | C21H26N2O2 |
| Molecular Weight | 338.45 g/mol |
| Exact Mass | 338.20 |
| IUPAC Name | N-(3,4-dimethylphenyl)-3-(4-morpholin-4-ylphenyl)propanamide |
| SMILES | Cc1ccc(NC(=O)CCc2ccc(N3CCOCC3)cc2)cc1C |
| InChI | InChI=1S/C21H26N2O2/c1-16-3-7-19(15-17(16)2)22-21(24)10-6-18-4-8-20(9-5-18)23-11-13-25-14-12-23/h3-5,7-9,15H,6,10-14H2,1-2H3,(H,22,24) |
| InChIKey | NOVMCGYDMHKFIN-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.45 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|