C17H15N3OS — CID 110649811
N-(4-ethylphenyl)-2-pyridin-2-yl-1,3-thiazole-4-carboxamide (PubChem CID 110649811) has the molecular formula C17H15N3OS and a molecular weight of 309.39 g/mol. Its IUPAC name is N-(4-ethylphenyl)-2-pyridin-2-yl-1,3-thiazole-4-carboxamide.
| Compound Name | N-(4-ethylphenyl)-2-pyridin-2-yl-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 110649811 |
| Molecular Formula | C17H15N3OS |
| Molecular Weight | 309.39 g/mol |
| Exact Mass | 309.09 |
| IUPAC Name | N-(4-ethylphenyl)-2-pyridin-2-yl-1,3-thiazole-4-carboxamide |
| SMILES | CCc1ccc(NC(=O)c2csc(-c3ccccn3)n2)cc1 |
| InChI | InChI=1S/C17H15N3OS/c1-2-12-6-8-13(9-7-12)19-16(21)15-11-22-17(20-15)14-5-3-4-10-18-14/h3-11H,2H2,1H3,(H,19,21) |
| InChIKey | FBFRRUXQNWLPMP-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.39 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |