C13H22O3Si — CID 11064995
methyl (E,5S)-5-hydroxy-9-trimethylsilylnon-8-en-6-ynoate (PubChem CID 11064995) has the molecular formula C13H22O3Si and a molecular weight of 254.40 g/mol. Its IUPAC name is methyl (E,5S)-5-hydroxy-9-trimethylsilylnon-8-en-6-ynoate.
| Compound Name | methyl (E,5S)-5-hydroxy-9-trimethylsilylnon-8-en-6-ynoate |
|---|---|
| PubChem CID | 11064995 |
| Molecular Formula | C13H22O3Si |
| Molecular Weight | 254.40 g/mol |
| Exact Mass | 254.13 |
| IUPAC Name | methyl (E,5S)-5-hydroxy-9-trimethylsilylnon-8-en-6-ynoate |
| SMILES | COC(=O)CCC[C@H](O)C#C/C=C/[Si](C)(C)C |
| InChI | InChI=1S/C13H22O3Si/c1-16-13(15)10-7-9-12(14)8-5-6-11-17(2,3)4/h6,11-12,14H,7,9-10H2,1-4H3/b11-6+/t12-/m1/s1 |
| InChIKey | QSBZQOXARXFWSR-IGEMTJHASA-N |
| XLogP | 2.13 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.40 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|