About tert-butyl-[(2S,3S,4S)-3-methoxy-4-methylhex-5-yn-2-yl]oxy-dimethylsilane
tert-butyl-[(2S,3S,4S)-3-methoxy-4-methylhex-5-yn-2-yl]oxy-dimethylsilane (PubChem CID 11065056) has the molecular formula C14H28O2Si
and a molecular weight of 256.46 g/mol. Its IUPAC name is tert-butyl-[(2S,3S,4S)-3-methoxy-4-methylhex-5-yn-2-yl]oxy-dimethylsilane.
Molecular Properties
| Compound Name | tert-butyl-[(2S,3S,4S)-3-methoxy-4-methylhex-5-yn-2-yl]oxy-dimethylsilane |
| PubChem CID | 11065056 |
| Molecular Formula | C14H28O2Si |
| Molecular Weight | 256.46 g/mol |
| Exact Mass | 256.19 |
| IUPAC Name | tert-butyl-[(2S,3S,4S)-3-methoxy-4-methylhex-5-yn-2-yl]oxy-dimethylsilane |
| SMILES | C#C[C@H](C)[C@H](OC)[C@H](C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C14H28O2Si/c1-10-11(2)13(15-7)12(3)16-17(8,9)14(4,5)6/h1,11-13H,2-9H3/t11-,12-,13-/m0/s1 |
| InChIKey | WJFPEDMBSGQJCF-AVGNSLFASA-N |
| XLogP | 3.68 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.46 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl-[(2S,3S,4S)-3-methoxy-4-methylhex-5-yn-2-yl]oxy-dimethylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl-[(2S,3S,4S)-3-methoxy-4-methylhex-5-yn-2-yl]oxy-dimethylsilane?
The IUPAC name of tert-butyl-[(2S,3S,4S)-3-methoxy-4-methylhex-5-yn-2-yl]oxy-dimethylsilane (CID 11065056) is tert-butyl-[(2S,3S,4S)-3-methoxy-4-methylhex-5-yn-2-yl]oxy-dimethylsilane.
What is the SMILES notation for tert-butyl-[(2S,3S,4S)-3-methoxy-4-methylhex-5-yn-2-yl]oxy-dimethylsilane?
The canonical SMILES for tert-butyl-[(2S,3S,4S)-3-methoxy-4-methylhex-5-yn-2-yl]oxy-dimethylsilane is C#C[C@H](C)[C@H](OC)[C@H](C)O[Si](C)(C)C(C)(C)C.
What is the InChIKey of tert-butyl-[(2S,3S,4S)-3-methoxy-4-methylhex-5-yn-2-yl]oxy-dimethylsilane?
The InChIKey is WJFPEDMBSGQJCF-AVGNSLFASA-N. The full InChI is InChI=1S/C14H28O2Si/c1-10-11(2)13(15-7)12(3)16-17(8,9)14(4,5)6/h1,11-13H,2-9H3/t11-,12-,13-/m0/s1.
What are the key properties of tert-butyl-[(2S,3S,4S)-3-methoxy-4-methylhex-5-yn-2-yl]oxy-dimethylsilane?
tert-butyl-[(2S,3S,4S)-3-methoxy-4-methylhex-5-yn-2-yl]oxy-dimethylsilane has a molecular weight of 256.46 g/mol, XLogP of 3.68, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl-[(2S,3S,4S)-3-methoxy-4-methylhex-5-yn-2-yl]oxy-dimethylsilane is sourced from PubChem (CID 11065056), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).