C20H18N2O3S — CID 110651262
ethyl 2-[(2-methyl-5-phenyl-1,3-thiazole-4-carbonyl)amino]benzoate (PubChem CID 110651262) has the molecular formula C20H18N2O3S and a molecular weight of 366.44 g/mol. Its IUPAC name is ethyl 2-[(2-methyl-5-phenyl-1,3-thiazole-4-carbonyl)amino]benzoate.
| Compound Name | ethyl 2-[(2-methyl-5-phenyl-1,3-thiazole-4-carbonyl)amino]benzoate |
|---|---|
| PubChem CID | 110651262 |
| Molecular Formula | C20H18N2O3S |
| Molecular Weight | 366.44 g/mol |
| Exact Mass | 366.10 |
| IUPAC Name | ethyl 2-[(2-methyl-5-phenyl-1,3-thiazole-4-carbonyl)amino]benzoate |
| SMILES | CCOC(=O)c1ccccc1NC(=O)c1nc(C)sc1-c1ccccc1 |
| InChI | InChI=1S/C20H18N2O3S/c1-3-25-20(24)15-11-7-8-12-16(15)22-19(23)17-18(26-13(2)21-17)14-9-5-4-6-10-14/h4-12H,3H2,1-2H3,(H,22,23) |
| InChIKey | ACQMZKWAQVSJSW-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.44 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |