About N-[(5-methyl-1,3,4-oxadiazol-2-yl)methyl]-N-propylpropan-1-amine
N-[(5-methyl-1,3,4-oxadiazol-2-yl)methyl]-N-propylpropan-1-amine (PubChem CID 110651557) has the molecular formula C10H19N3O
and a molecular weight of 197.28 g/mol. Its IUPAC name is N-[(5-methyl-1,3,4-oxadiazol-2-yl)methyl]-N-propylpropan-1-amine.
Molecular Properties
| Compound Name | N-[(5-methyl-1,3,4-oxadiazol-2-yl)methyl]-N-propylpropan-1-amine |
| PubChem CID | 110651557 |
| Molecular Formula | C10H19N3O |
| Molecular Weight | 197.28 g/mol |
| Exact Mass | 197.15 |
| IUPAC Name | N-[(5-methyl-1,3,4-oxadiazol-2-yl)methyl]-N-propylpropan-1-amine |
| SMILES | CCCN(CCC)Cc1nnc(C)o1 |
| InChI | InChI=1S/C10H19N3O/c1-4-6-13(7-5-2)8-10-12-11-9(3)14-10/h4-8H2,1-3H3 |
| InChIKey | VYBWFPLUUBEPSQ-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 42.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.28 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-[(5-methyl-1,3,4-oxadiazol-2-yl)methyl]-N-propylpropan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(5-methyl-1,3,4-oxadiazol-2-yl)methyl]-N-propylpropan-1-amine?
The IUPAC name of N-[(5-methyl-1,3,4-oxadiazol-2-yl)methyl]-N-propylpropan-1-amine (CID 110651557) is N-[(5-methyl-1,3,4-oxadiazol-2-yl)methyl]-N-propylpropan-1-amine.
What is the SMILES notation for N-[(5-methyl-1,3,4-oxadiazol-2-yl)methyl]-N-propylpropan-1-amine?
The canonical SMILES for N-[(5-methyl-1,3,4-oxadiazol-2-yl)methyl]-N-propylpropan-1-amine is CCCN(CCC)Cc1nnc(C)o1.
What is the InChIKey of N-[(5-methyl-1,3,4-oxadiazol-2-yl)methyl]-N-propylpropan-1-amine?
The InChIKey is VYBWFPLUUBEPSQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H19N3O/c1-4-6-13(7-5-2)8-10-12-11-9(3)14-10/h4-8H2,1-3H3.
What are the key properties of N-[(5-methyl-1,3,4-oxadiazol-2-yl)methyl]-N-propylpropan-1-amine?
N-[(5-methyl-1,3,4-oxadiazol-2-yl)methyl]-N-propylpropan-1-amine has a molecular weight of 197.28 g/mol, XLogP of 2.00, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(5-methyl-1,3,4-oxadiazol-2-yl)methyl]-N-propylpropan-1-amine is sourced from PubChem (CID 110651557), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).