C21H24N4O2 — CID 110652691
N-[[5-(2-methoxyphenyl)-1,3,4-oxadiazol-2-yl]methyl]-4-piperidin-1-ylaniline (PubChem CID 110652691) has the molecular formula C21H24N4O2 and a molecular weight of 364.45 g/mol. Its IUPAC name is N-[[5-(2-methoxyphenyl)-1,3,4-oxadiazol-2-yl]methyl]-4-piperidin-1-ylaniline.
| Compound Name | N-[[5-(2-methoxyphenyl)-1,3,4-oxadiazol-2-yl]methyl]-4-piperidin-1-ylaniline |
|---|---|
| PubChem CID | 110652691 |
| Molecular Formula | C21H24N4O2 |
| Molecular Weight | 364.45 g/mol |
| Exact Mass | 364.19 |
| IUPAC Name | N-[[5-(2-methoxyphenyl)-1,3,4-oxadiazol-2-yl]methyl]-4-piperidin-1-ylaniline |
| SMILES | COc1ccccc1-c1nnc(CNc2ccc(N3CCCCC3)cc2)o1 |
| InChI | InChI=1S/C21H24N4O2/c1-26-19-8-4-3-7-18(19)21-24-23-20(27-21)15-22-16-9-11-17(12-10-16)25-13-5-2-6-14-25/h3-4,7-12,22H,2,5-6,13-15H2,1H3 |
| InChIKey | COPOJCJRATVLCA-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 63.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.45 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|