C19H21N3O — CID 110653353
N-[(5-benzyl-1,3,4-oxadiazol-2-yl)methyl]-2,4,6-trimethylaniline (PubChem CID 110653353) has the molecular formula C19H21N3O and a molecular weight of 307.40 g/mol. Its IUPAC name is N-[(5-benzyl-1,3,4-oxadiazol-2-yl)methyl]-2,4,6-trimethylaniline.
| Compound Name | N-[(5-benzyl-1,3,4-oxadiazol-2-yl)methyl]-2,4,6-trimethylaniline |
|---|---|
| PubChem CID | 110653353 |
| Molecular Formula | C19H21N3O |
| Molecular Weight | 307.40 g/mol |
| Exact Mass | 307.17 |
| IUPAC Name | N-[(5-benzyl-1,3,4-oxadiazol-2-yl)methyl]-2,4,6-trimethylaniline |
| SMILES | Cc1cc(C)c(NCc2nnc(Cc3ccccc3)o2)c(C)c1 |
| InChI | InChI=1S/C19H21N3O/c1-13-9-14(2)19(15(3)10-13)20-12-18-22-21-17(23-18)11-16-7-5-4-6-8-16/h4-10,20H,11-12H2,1-3H3 |
| InChIKey | PHQDUONTRDDSGH-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 50.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.40 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |