C14H21NO4 — CID 11065411
(4R)-3-but-3-enyl-4-[(4R,5R)-5-ethenyl-2,2-dimethyl-1,3-dioxolan-4-yl]-1,3-oxazolidin-2-one (PubChem CID 11065411) has the molecular formula C14H21NO4 and a molecular weight of 267.32 g/mol. Its IUPAC name is (4R)-3-but-3-enyl-4-[(4R,5R)-5-ethenyl-2,2-dimethyl-1,3-dioxolan-4-yl]-1,3-oxazolidin-2-one.
| Compound Name | (4R)-3-but-3-enyl-4-[(4R,5R)-5-ethenyl-2,2-dimethyl-1,3-dioxolan-4-yl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 11065411 |
| Molecular Formula | C14H21NO4 |
| Molecular Weight | 267.32 g/mol |
| Exact Mass | 267.15 |
| IUPAC Name | (4R)-3-but-3-enyl-4-[(4R,5R)-5-ethenyl-2,2-dimethyl-1,3-dioxolan-4-yl]-1,3-oxazolidin-2-one |
| SMILES | C=CCCN1C(=O)OC[C@@H]1[C@H]1OC(C)(C)O[C@@H]1C=C |
| InChI | InChI=1S/C14H21NO4/c1-5-7-8-15-10(9-17-13(15)16)12-11(6-2)18-14(3,4)19-12/h5-6,10-12H,1-2,7-9H2,3-4H3/t10-,11-,12-/m1/s1 |
| InChIKey | BTSJDISZUUWTNE-IJLUTSLNSA-N |
| XLogP | 2.09 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.32 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|