C12H13FN2O4 — CID 11065432
(4R)-2-(3-ethoxy-4-fluorophenyl)-N-hydroxy-4,5-dihydro-1,3-oxazole-4-carboxamide (PubChem CID 11065432) has the molecular formula C12H13FN2O4 and a molecular weight of 268.24 g/mol. Its IUPAC name is (4R)-2-(3-ethoxy-4-fluorophenyl)-N-hydroxy-4,5-dihydro-1,3-oxazole-4-carboxamide.
| Compound Name | (4R)-2-(3-ethoxy-4-fluorophenyl)-N-hydroxy-4,5-dihydro-1,3-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 11065432 |
| Molecular Formula | C12H13FN2O4 |
| Molecular Weight | 268.24 g/mol |
| Exact Mass | 268.09 |
| IUPAC Name | (4R)-2-(3-ethoxy-4-fluorophenyl)-N-hydroxy-4,5-dihydro-1,3-oxazole-4-carboxamide |
| SMILES | CCOc1cc(C2=N[C@@H](C(=O)NO)CO2)ccc1F |
| InChI | InChI=1S/C12H13FN2O4/c1-2-18-10-5-7(3-4-8(10)13)12-14-9(6-19-12)11(16)15-17/h3-5,9,17H,2,6H2,1H3,(H,15,16)/t9-/m1/s1 |
| InChIKey | MEWMECOTKZWTEZ-SECBINFHSA-N |
| XLogP | 0.88 |
| TPSA | 80.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.24 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|