C21H28N2O2 — CID 110655150
1-(1-cyclohexyl-2,5-dimethylpyrrol-3-yl)-2-(4-methoxyanilino)ethanone (PubChem CID 110655150) has the molecular formula C21H28N2O2 and a molecular weight of 340.47 g/mol. Its IUPAC name is 1-(1-cyclohexyl-2,5-dimethylpyrrol-3-yl)-2-(4-methoxyanilino)ethanone.
| Compound Name | 1-(1-cyclohexyl-2,5-dimethylpyrrol-3-yl)-2-(4-methoxyanilino)ethanone |
|---|---|
| PubChem CID | 110655150 |
| Molecular Formula | C21H28N2O2 |
| Molecular Weight | 340.47 g/mol |
| Exact Mass | 340.22 |
| IUPAC Name | 1-(1-cyclohexyl-2,5-dimethylpyrrol-3-yl)-2-(4-methoxyanilino)ethanone |
| SMILES | COc1ccc(NCC(=O)c2cc(C)n(C3CCCCC3)c2C)cc1 |
| InChI | InChI=1S/C21H28N2O2/c1-15-13-20(16(2)23(15)18-7-5-4-6-8-18)21(24)14-22-17-9-11-19(25-3)12-10-17/h9-13,18,22H,4-8,14H2,1-3H3 |
| InChIKey | RMPHSVDMOHSXKO-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 43.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.47 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|