C18H14ClF3N2O — CID 110655508
2-[4-chloro-2-(trifluoromethyl)anilino]-1-(1-methylindol-3-yl)ethanone (PubChem CID 110655508) has the molecular formula C18H14ClF3N2O and a molecular weight of 366.77 g/mol. Its IUPAC name is 2-[4-chloro-2-(trifluoromethyl)anilino]-1-(1-methylindol-3-yl)ethanone.
| Compound Name | 2-[4-chloro-2-(trifluoromethyl)anilino]-1-(1-methylindol-3-yl)ethanone |
|---|---|
| PubChem CID | 110655508 |
| Molecular Formula | C18H14ClF3N2O |
| Molecular Weight | 366.77 g/mol |
| Exact Mass | 366.07 |
| IUPAC Name | 2-[4-chloro-2-(trifluoromethyl)anilino]-1-(1-methylindol-3-yl)ethanone |
| SMILES | Cn1cc(C(=O)CNc2ccc(Cl)cc2C(F)(F)F)c2ccccc21 |
| InChI | InChI=1S/C18H14ClF3N2O/c1-24-10-13(12-4-2-3-5-16(12)24)17(25)9-23-15-7-6-11(19)8-14(15)18(20,21)22/h2-8,10,23H,9H2,1H3 |
| InChIKey | BICRUIGWLQXKRC-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 34.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.77 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |