About 1-iodo-2-(propa-1,2-dienoxymethyl)benzene
1-iodo-2-(propa-1,2-dienoxymethyl)benzene (PubChem CID 11065564) has the molecular formula C10H9IO
and a molecular weight of 272.09 g/mol. Its IUPAC name is 1-iodo-2-(propa-1,2-dienoxymethyl)benzene.
Molecular Properties
| Compound Name | 1-iodo-2-(propa-1,2-dienoxymethyl)benzene |
| PubChem CID | 11065564 |
| Molecular Formula | C10H9IO |
| Molecular Weight | 272.09 g/mol |
| Exact Mass | 271.97 |
| IUPAC Name | 1-iodo-2-(propa-1,2-dienoxymethyl)benzene |
| SMILES | C=C=COCc1ccccc1I |
| InChI | InChI=1S/C10H9IO/c1-2-7-12-8-9-5-3-4-6-10(9)11/h3-7H,1,8H2 |
| InChIKey | WFZNCDBOZCZMFY-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.09 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 1-iodo-2-(propa-1,2-dienoxymethyl)benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-iodo-2-(propa-1,2-dienoxymethyl)benzene?
The IUPAC name of 1-iodo-2-(propa-1,2-dienoxymethyl)benzene (CID 11065564) is 1-iodo-2-(propa-1,2-dienoxymethyl)benzene.
What is the SMILES notation for 1-iodo-2-(propa-1,2-dienoxymethyl)benzene?
The canonical SMILES for 1-iodo-2-(propa-1,2-dienoxymethyl)benzene is C=C=COCc1ccccc1I.
What is the InChIKey of 1-iodo-2-(propa-1,2-dienoxymethyl)benzene?
The InChIKey is WFZNCDBOZCZMFY-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9IO/c1-2-7-12-8-9-5-3-4-6-10(9)11/h3-7H,1,8H2.
What are the key properties of 1-iodo-2-(propa-1,2-dienoxymethyl)benzene?
1-iodo-2-(propa-1,2-dienoxymethyl)benzene has a molecular weight of 272.09 g/mol, XLogP of 3.11, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-iodo-2-(propa-1,2-dienoxymethyl)benzene is sourced from PubChem (CID 11065564), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).