C18H18N2O4 — CID 110655825
2-[(3-ethoxyphenoxy)methyl]-5-(3-methoxyphenyl)-1,3,4-oxadiazole (PubChem CID 110655825) has the molecular formula C18H18N2O4 and a molecular weight of 326.35 g/mol. Its IUPAC name is 2-[(3-ethoxyphenoxy)methyl]-5-(3-methoxyphenyl)-1,3,4-oxadiazole.
| Compound Name | 2-[(3-ethoxyphenoxy)methyl]-5-(3-methoxyphenyl)-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 110655825 |
| Molecular Formula | C18H18N2O4 |
| Molecular Weight | 326.35 g/mol |
| Exact Mass | 326.13 |
| IUPAC Name | 2-[(3-ethoxyphenoxy)methyl]-5-(3-methoxyphenyl)-1,3,4-oxadiazole |
| SMILES | CCOc1cccc(OCc2nnc(-c3cccc(OC)c3)o2)c1 |
| InChI | InChI=1S/C18H18N2O4/c1-3-22-15-8-5-9-16(11-15)23-12-17-19-20-18(24-17)13-6-4-7-14(10-13)21-2/h4-11H,3,12H2,1-2H3 |
| InChIKey | OKGZDLJRAZEWJV-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 66.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.35 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |