C16H19NO3 — CID 11065621
ethyl (3Z)-3-(3,3-dimethyl-2,4-dihydroisoquinolin-1-ylidene)-2-oxopropanoate (PubChem CID 11065621) has the molecular formula C16H19NO3 and a molecular weight of 273.33 g/mol. Its IUPAC name is ethyl (3Z)-3-(3,3-dimethyl-2,4-dihydroisoquinolin-1-ylidene)-2-oxopropanoate.
| Compound Name | ethyl (3Z)-3-(3,3-dimethyl-2,4-dihydroisoquinolin-1-ylidene)-2-oxopropanoate |
|---|---|
| PubChem CID | 11065621 |
| Molecular Formula | C16H19NO3 |
| Molecular Weight | 273.33 g/mol |
| Exact Mass | 273.14 |
| IUPAC Name | ethyl (3Z)-3-(3,3-dimethyl-2,4-dihydroisoquinolin-1-ylidene)-2-oxopropanoate |
| SMILES | CCOC(=O)C(=O)/C=C1\NC(C)(C)Cc2ccccc21 |
| InChI | InChI=1S/C16H19NO3/c1-4-20-15(19)14(18)9-13-12-8-6-5-7-11(12)10-16(2,3)17-13/h5-9,17H,4,10H2,1-3H3/b13-9- |
| InChIKey | FXQFMFUKANVWRG-LCYFTJDESA-N |
| XLogP | 2.08 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.33 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|