C22H20FN3O4 — CID 110657054
2-[4-[2-(2-fluorophenyl)-3-oxopiperazin-1-yl]-4-oxobutyl]isoindole-1,3-dione (PubChem CID 110657054) has the molecular formula C22H20FN3O4 and a molecular weight of 409.42 g/mol. Its IUPAC name is 2-[4-[2-(2-fluorophenyl)-3-oxopiperazin-1-yl]-4-oxobutyl]isoindole-1,3-dione.
| Compound Name | 2-[4-[2-(2-fluorophenyl)-3-oxopiperazin-1-yl]-4-oxobutyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 110657054 |
| Molecular Formula | C22H20FN3O4 |
| Molecular Weight | 409.42 g/mol |
| Exact Mass | 409.14 |
| IUPAC Name | 2-[4-[2-(2-fluorophenyl)-3-oxopiperazin-1-yl]-4-oxobutyl]isoindole-1,3-dione |
| SMILES | O=C1NCCN(C(=O)CCCN2C(=O)c3ccccc3C2=O)C1c1ccccc1F |
| InChI | InChI=1S/C22H20FN3O4/c23-17-9-4-3-8-16(17)19-20(28)24-11-13-25(19)18(27)10-5-12-26-21(29)14-6-1-2-7-15(14)22(26)30/h1-4,6-9,19H,5,10-13H2,(H,24,28) |
| InChIKey | SYSOFOFLFBSDKX-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.42 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|