C18H19FN2O3S — CID 110657265
4-(4-fluoro-3-methylphenyl)sulfonyl-3-(2-methylphenyl)piperazin-2-one (PubChem CID 110657265) has the molecular formula C18H19FN2O3S and a molecular weight of 362.43 g/mol. Its IUPAC name is 4-(4-fluoro-3-methylphenyl)sulfonyl-3-(2-methylphenyl)piperazin-2-one.
| Compound Name | 4-(4-fluoro-3-methylphenyl)sulfonyl-3-(2-methylphenyl)piperazin-2-one |
|---|---|
| PubChem CID | 110657265 |
| Molecular Formula | C18H19FN2O3S |
| Molecular Weight | 362.43 g/mol |
| Exact Mass | 362.11 |
| IUPAC Name | 4-(4-fluoro-3-methylphenyl)sulfonyl-3-(2-methylphenyl)piperazin-2-one |
| SMILES | Cc1cc(S(=O)(=O)N2CCNC(=O)C2c2ccccc2C)ccc1F |
| InChI | InChI=1S/C18H19FN2O3S/c1-12-5-3-4-6-15(12)17-18(22)20-9-10-21(17)25(23,24)14-7-8-16(19)13(2)11-14/h3-8,11,17H,9-10H2,1-2H3,(H,20,22) |
| InChIKey | FSPDCVZACRNFDH-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.43 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |