About tert-butyl (4S,5S)-5-hydroxy-4-methyl-3-oxo-5-phenylpentanoate
tert-butyl (4S,5S)-5-hydroxy-4-methyl-3-oxo-5-phenylpentanoate (PubChem CID 11065778) has the molecular formula C16H22O4
and a molecular weight of 278.35 g/mol. Its IUPAC name is tert-butyl (4S,5S)-5-hydroxy-4-methyl-3-oxo-5-phenylpentanoate.
Molecular Properties
| Compound Name | tert-butyl (4S,5S)-5-hydroxy-4-methyl-3-oxo-5-phenylpentanoate |
| PubChem CID | 11065778 |
| Molecular Formula | C16H22O4 |
| Molecular Weight | 278.35 g/mol |
| Exact Mass | 278.15 |
| IUPAC Name | tert-butyl (4S,5S)-5-hydroxy-4-methyl-3-oxo-5-phenylpentanoate |
| SMILES | C[C@H](C(=O)CC(=O)OC(C)(C)C)[C@H](O)c1ccccc1 |
| InChI | InChI=1S/C16H22O4/c1-11(15(19)12-8-6-5-7-9-12)13(17)10-14(18)20-16(2,3)4/h5-9,11,15,19H,10H2,1-4H3/t11-,15+/m1/s1 |
| InChIKey | DRYNAXQNYIJTLJ-ABAIWWIYSA-N |
| XLogP | 2.66 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.35 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl (4S,5S)-5-hydroxy-4-methyl-3-oxo-5-phenylpentanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl (4S,5S)-5-hydroxy-4-methyl-3-oxo-5-phenylpentanoate?
The IUPAC name of tert-butyl (4S,5S)-5-hydroxy-4-methyl-3-oxo-5-phenylpentanoate (CID 11065778) is tert-butyl (4S,5S)-5-hydroxy-4-methyl-3-oxo-5-phenylpentanoate.
What is the SMILES notation for tert-butyl (4S,5S)-5-hydroxy-4-methyl-3-oxo-5-phenylpentanoate?
The canonical SMILES for tert-butyl (4S,5S)-5-hydroxy-4-methyl-3-oxo-5-phenylpentanoate is C[C@H](C(=O)CC(=O)OC(C)(C)C)[C@H](O)c1ccccc1.
What is the InChIKey of tert-butyl (4S,5S)-5-hydroxy-4-methyl-3-oxo-5-phenylpentanoate?
The InChIKey is DRYNAXQNYIJTLJ-ABAIWWIYSA-N. The full InChI is InChI=1S/C16H22O4/c1-11(15(19)12-8-6-5-7-9-12)13(17)10-14(18)20-16(2,3)4/h5-9,11,15,19H,10H2,1-4H3/t11-,15+/m1/s1.
What are the key properties of tert-butyl (4S,5S)-5-hydroxy-4-methyl-3-oxo-5-phenylpentanoate?
tert-butyl (4S,5S)-5-hydroxy-4-methyl-3-oxo-5-phenylpentanoate has a molecular weight of 278.35 g/mol, XLogP of 2.66, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl (4S,5S)-5-hydroxy-4-methyl-3-oxo-5-phenylpentanoate is sourced from PubChem (CID 11065778), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).