C23H32N2O — CID 110657845
1-adamantyl-(4-benzyl-3-methylpiperazin-1-yl)methanone (PubChem CID 110657845) has the molecular formula C23H32N2O and a molecular weight of 352.52 g/mol. Its IUPAC name is 1-adamantyl-(4-benzyl-3-methylpiperazin-1-yl)methanone.
| Compound Name | 1-adamantyl-(4-benzyl-3-methylpiperazin-1-yl)methanone |
|---|---|
| PubChem CID | 110657845 |
| Molecular Formula | C23H32N2O |
| Molecular Weight | 352.52 g/mol |
| Exact Mass | 352.25 |
| IUPAC Name | 1-adamantyl-(4-benzyl-3-methylpiperazin-1-yl)methanone |
| SMILES | CC1CN(C(=O)C23CC4CC(CC(C4)C2)C3)CCN1Cc1ccccc1 |
| InChI | InChI=1S/C23H32N2O/c1-17-15-25(8-7-24(17)16-18-5-3-2-4-6-18)22(26)23-12-19-9-20(13-23)11-21(10-19)14-23/h2-6,17,19-21H,7-16H2,1H3 |
| InChIKey | HTJBGDPYOSPTSH-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.52 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |