About (2R,4S)-3-benzoyl-4-methyl-2-phenyl-1,3-oxazolidin-5-one
(2R,4S)-3-benzoyl-4-methyl-2-phenyl-1,3-oxazolidin-5-one (PubChem CID 11065866) has the molecular formula C17H15NO3
and a molecular weight of 281.31 g/mol. Its IUPAC name is (2R,4S)-3-benzoyl-4-methyl-2-phenyl-1,3-oxazolidin-5-one.
Molecular Properties
| Compound Name | (2R,4S)-3-benzoyl-4-methyl-2-phenyl-1,3-oxazolidin-5-one |
| PubChem CID | 11065866 |
| Molecular Formula | C17H15NO3 |
| Molecular Weight | 281.31 g/mol |
| Exact Mass | 281.11 |
| IUPAC Name | (2R,4S)-3-benzoyl-4-methyl-2-phenyl-1,3-oxazolidin-5-one |
| SMILES | C[C@H]1C(=O)O[C@H](c2ccccc2)N1C(=O)c1ccccc1 |
| InChI | InChI=1S/C17H15NO3/c1-12-17(20)21-16(14-10-6-3-7-11-14)18(12)15(19)13-8-4-2-5-9-13/h2-12,16H,1H3/t12-,16+/m0/s1 |
| InChIKey | XWBOGYZALFWLOF-BLLLJJGKSA-N |
| XLogP | 2.77 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.31 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2R,4S)-3-benzoyl-4-methyl-2-phenyl-1,3-oxazolidin-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R,4S)-3-benzoyl-4-methyl-2-phenyl-1,3-oxazolidin-5-one?
The IUPAC name of (2R,4S)-3-benzoyl-4-methyl-2-phenyl-1,3-oxazolidin-5-one (CID 11065866) is (2R,4S)-3-benzoyl-4-methyl-2-phenyl-1,3-oxazolidin-5-one.
What is the SMILES notation for (2R,4S)-3-benzoyl-4-methyl-2-phenyl-1,3-oxazolidin-5-one?
The canonical SMILES for (2R,4S)-3-benzoyl-4-methyl-2-phenyl-1,3-oxazolidin-5-one is C[C@H]1C(=O)O[C@H](c2ccccc2)N1C(=O)c1ccccc1.
What is the InChIKey of (2R,4S)-3-benzoyl-4-methyl-2-phenyl-1,3-oxazolidin-5-one?
The InChIKey is XWBOGYZALFWLOF-BLLLJJGKSA-N. The full InChI is InChI=1S/C17H15NO3/c1-12-17(20)21-16(14-10-6-3-7-11-14)18(12)15(19)13-8-4-2-5-9-13/h2-12,16H,1H3/t12-,16+/m0/s1.
What are the key properties of (2R,4S)-3-benzoyl-4-methyl-2-phenyl-1,3-oxazolidin-5-one?
(2R,4S)-3-benzoyl-4-methyl-2-phenyl-1,3-oxazolidin-5-one has a molecular weight of 281.31 g/mol, XLogP of 2.77, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2R,4S)-3-benzoyl-4-methyl-2-phenyl-1,3-oxazolidin-5-one is sourced from PubChem (CID 11065866), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).