C16H31NOSi — CID 11065881
(E,1R,4R)-N-[tert-butyl(dimethyl)silyl]oxy-1,7,7-trimethylbicyclo[2.2.1]heptan-2-imine (PubChem CID 11065881) has the molecular formula C16H31NOSi and a molecular weight of 281.52 g/mol. Its IUPAC name is (E,1R,4R)-N-[tert-butyl(dimethyl)silyl]oxy-1,7,7-trimethylbicyclo[2.2.1]heptan-2-imine.
| Compound Name | (E,1R,4R)-N-[tert-butyl(dimethyl)silyl]oxy-1,7,7-trimethylbicyclo[2.2.1]heptan-2-imine |
|---|---|
| PubChem CID | 11065881 |
| Molecular Formula | C16H31NOSi |
| Molecular Weight | 281.52 g/mol |
| Exact Mass | 281.22 |
| IUPAC Name | (E,1R,4R)-N-[tert-butyl(dimethyl)silyl]oxy-1,7,7-trimethylbicyclo[2.2.1]heptan-2-imine |
| SMILES | CC1(C)[C@@H]2CC[C@@]1(C)/C(=N/O[Si](C)(C)C(C)(C)C)C2 |
| InChI | InChI=1S/C16H31NOSi/c1-14(2,3)19(7,8)18-17-13-11-12-9-10-16(13,6)15(12,4)5/h12H,9-11H2,1-8H3/b17-13+/t12-,16+/m1/s1 |
| InChIKey | JLYLMCONIYGRGE-BQRJLUARSA-N |
| XLogP | 5.21 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.52 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|