About [ethoxy(dimethyl)silyl] triethyl silicate
[ethoxy(dimethyl)silyl] triethyl silicate (PubChem CID 11065925) has the molecular formula C10H26O5Si2
and a molecular weight of 282.48 g/mol. Its IUPAC name is [ethoxy(dimethyl)silyl] triethyl silicate.
Molecular Properties
| Compound Name | [ethoxy(dimethyl)silyl] triethyl silicate |
| PubChem CID | 11065925 |
| Molecular Formula | C10H26O5Si2 |
| Molecular Weight | 282.48 g/mol |
| Exact Mass | 282.13 |
| IUPAC Name | [ethoxy(dimethyl)silyl] triethyl silicate |
| SMILES | CCO[Si](C)(C)O[Si](OCC)(OCC)OCC |
| InChI | InChI=1S/C10H26O5Si2/c1-7-11-16(5,6)15-17(12-8-2,13-9-3)14-10-4/h7-10H2,1-6H3 |
| InChIKey | OYRRQADPTVZBPP-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.48 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze [ethoxy(dimethyl)silyl] triethyl silicate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [ethoxy(dimethyl)silyl] triethyl silicate?
The IUPAC name of [ethoxy(dimethyl)silyl] triethyl silicate (CID 11065925) is [ethoxy(dimethyl)silyl] triethyl silicate.
What is the SMILES notation for [ethoxy(dimethyl)silyl] triethyl silicate?
The canonical SMILES for [ethoxy(dimethyl)silyl] triethyl silicate is CCO[Si](C)(C)O[Si](OCC)(OCC)OCC.
What is the InChIKey of [ethoxy(dimethyl)silyl] triethyl silicate?
The InChIKey is OYRRQADPTVZBPP-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H26O5Si2/c1-7-11-16(5,6)15-17(12-8-2,13-9-3)14-10-4/h7-10H2,1-6H3.
What are the key properties of [ethoxy(dimethyl)silyl] triethyl silicate?
[ethoxy(dimethyl)silyl] triethyl silicate has a molecular weight of 282.48 g/mol, XLogP of 2.29, 10 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [ethoxy(dimethyl)silyl] triethyl silicate is sourced from PubChem (CID 11065925), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).